Target Relevance

Molecular Definition

Canonical SMILES CC[C@@H]1OCC(=O)[C@H]1NC(=O)[C@H](CC2(C)CCCC2)NC(=O)c3ccc(NS(=O)(=O)C)c(Cl)c3
Formula C23H32ClN3O6S
Molecular Weight 514.04 da
Stereocenters 3/3