Target Relevance

Molecular Definition

Canonical SMILES CCN(C(C)C)c1nc(N)c(nc1Cl)C(=O)NC(=N)N
Formula C11H18ClN7O
Molecular Weight 299.76 da
Stereocenters 0/0