Molecular Definition

Canonical SMILES CN(CCCCON)C[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2c(C)nc3c(N)ncnc23.OS(=O)(=O)O
Formula C16H29N7O8S
Molecular Weight 479.51 da
Stereocenters 4/4