Molecular Definition

Canonical SMILES N[C@@H](CC(=C1CCCC1)C(=O)O)C(=O)O
Formula C10H15NO4
Molecular Weight 213.23 da
Stereocenters 1/1