Molecular Definition

Canonical SMILES CCc1c(C(=O)C(=O)N)c2c(OC)cc3ccccc3c2n1Cc4ccccc4
Formula C24H22N2O3
Molecular Weight 386.44 da
Stereocenters 0/0