Molecular Definition

Canonical SMILES CC(C)c1n[nH]c2C(=O)NC(=Nc12)C[C@@H]3CCCC[C@H]3OCCN4CCOCC4
Formula C21H33N5O3
Molecular Weight 403.52 da
Stereocenters 2/2