Target Relevance

Molecular Definition

Canonical SMILES CC(=O)C1=C(Nc2ccc(Cl)cc2)Nc3c(Br)ccc(Cl)c3C1=O
Formula C17H11BrCl2N2O2
Molecular Weight 426.09 da
Stereocenters 0/0