Molecular Definition

Canonical SMILES FC(F)(F)c1ccc(cc1)c2nc(c[nH]2)c3ccccc3
Formula C16H11F3N2
Molecular Weight 288.27 da
Stereocenters 0/0