Molecular Definition

Canonical SMILES S(Sc1nc2ccccc2s1)c3nc4ccccc4s3
Formula C14H8N2S4
Molecular Weight 332.49 da
Stereocenters 0/0