Molecular Definition

Canonical SMILES FC(F)(F)C(=O)c1ccc(s1)c2onc(Cc3cccs3)n2
Formula C13H7F3N2O2S2
Molecular Weight 344.33 da
Stereocenters 0/0