Target Relevance

Molecular Definition

Canonical SMILES CS(=O)(=O)NCC#CN1[C@@H]([C@@H](CC[C@H](O)c2ccc(F)cc2)C1=O)c3ccc(O[C@@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4O)C(=O)O)cc3
Formula C28H31FN2O11S
Molecular Weight 622.62 da
Stereocenters 8/8