Molecular Definition

Canonical SMILES CC(C)NCC(O)COc1cccc2[nH]ccc12
Formula C14H20N2O2
Molecular Weight 248.32 da
Stereocenters 0/1