Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/C[C@H]1OC(=O)C=C1C)\CC[C@H]2[C@](C)(O)C[C@H](O)[C@H]3[C@](C)(CO)CCC[C@]23C
Formula C25H40O5
Molecular Weight 420.58 da
Stereocenters 7/7