Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/C=C/1\OC(=O)C=C1C)\CC[C@H]2[C@](C)(O)C[C@H](O)[C@H]3[C@@](C)(CCC[C@]23C)C=O
Formula C25H36O5
Molecular Weight 416.55 da
Stereocenters 6/6