Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/C=C/1\OC(=O)C=C1C)\CC[C@H]2[C@](C)(O)C[C@H](O)[C@@H]3[C@]2(C)CCC[C@@]3(C)C(=O)O
Formula C25H36O6
Molecular Weight 432.55 da
Stereocenters 6/6