Molecular Definition

Canonical SMILES OC(=O)c1ccc(cc1O)c2ccc(CC3=C(Oc4ccccc4C3=O)c5ccc(O)cc5)cc2
Formula C29H20O6
Molecular Weight 464.47 da
Stereocenters 0/0