Molecular Definition

Canonical SMILES N[C@@H](CCC(=O)N1CCc2nc(sc2C1)c3ccc(F)cc3)C(=O)N4CCC[C@H]4C#N.OC(=O)C(F)(F)F
Formula C24H25F4N5O4S
Molecular Weight 555.55 da
Stereocenters 2/2