Target Relevance

Molecular Definition

Canonical SMILES Cc1c(nn(c2ccc(Cl)cc2Cl)c1c3ccc(C#CC4CCCC4)s3)C(=O)NN5CC6CCCC6C5
Formula C29H30Cl2N4OS
Molecular Weight 553.55 da
Stereocenters 0/2