Target Relevance

Molecular Definition

Canonical SMILES Oc1ccc(CCNc2ncnc3ccc(Cl)cc23)cc1
Formula C16H14ClN3O
Molecular Weight 299.76 da
Stereocenters 0/0