Molecular Definition

Canonical SMILES COc1cc(O)c2C(=O)C(=COc2c1)c3ccc(O)cc3
Formula C16H12O5
Molecular Weight 284.26 da
Stereocenters 0/0