Target Relevance

Molecular Definition

Canonical SMILES Cc1oc(nc1C(=O)N=C(N)N)c2cc(Cl)cc(Cl)c2.CS(=O)(=O)O
Formula C13H14Cl2N4O5S
Molecular Weight 409.25 da
Stereocenters 0/0