Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(F)cc1c2nc(C(=O)N=C(N)N)c(C)[nH]2.CS(=O)(=O)O.CS(=O)(=O)O
Formula C15H22FN5O8S2
Molecular Weight 483.49 da
Stereocenters 0/0