Molecular Definition

Canonical SMILES CC(C)n1c(C)ncc1c2ccnc(Nc3ccc(cc3)S(=O)(=O)C)n2
Formula C18H21N5O2S
Molecular Weight 371.46 da
Stereocenters 0/0