Molecular Definition

Canonical SMILES CCOC(=O)c1cnc2c(cnn2CC)c1Nc3ccc(OC)cc3
Formula C18H20N4O3
Molecular Weight 340.38 da
Stereocenters 0/0