Target Relevance

Molecular Definition

Canonical SMILES CCN(CC)CCOc1cccc(c1)c2nc3N(C)C(=O)N(C)C(=O)c3[nH]2
Formula C19H25N5O3
Molecular Weight 371.43 da
Stereocenters 0/0