Molecular Definition

Canonical SMILES CCc1cc(Cc2c(C)cc(OCP(=O)(O)O)cc2C)ccc1O
Formula C18H23O5P
Molecular Weight 350.35 da
Stereocenters 0/0