Molecular Definition

Canonical SMILES Cc1cccc(C)c1NC(=O)[C@@H]2CCCN2Cc3ccccc3
Formula C20H24N2O
Molecular Weight 308.42 da
Stereocenters 1/1