Molecular Definition

Canonical SMILES CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCC(=O)NCC2CC2)c1
Formula C27H45NO3
Molecular Weight 431.65 da
Stereocenters 0/0