Molecular Definition

Canonical SMILES Cc1cccc(C)c1SC[C@H](N)c2ccccc2
Formula C16H19NS
Molecular Weight 257.39 da
Stereocenters 1/1