Molecular Definition

Canonical SMILES COc1cc(\C=C\C(=O)OCCc2ccc(O)cc2)ccc1O
Formula C18H18O5
Molecular Weight 314.33 da
Stereocenters 0/0