Molecular Definition

Canonical SMILES OC(=O)[C@]1(C[C@H]1c2ccccc2)N(CCN3CCCC3=O)S(=O)(=O)N4CCC(=CC4)c5ccc(Cl)cc5
Formula C27H30ClN3O5S
Molecular Weight 544.06 da
Stereocenters 2/2