Molecular Definition

Canonical SMILES N[C@@H](CCC(=O)N1CCN(CC1)c2ccncc2)C(=O)N3CCC[C@H]3C#N.OC(=O)C(F)(F)F
Formula C21H27F3N6O4
Molecular Weight 484.47 da
Stereocenters 2/2