Molecular Definition

Canonical SMILES Cc1ccc(cc1)C(NC(=O)CNc2ccc(cc2)C#N)c3cc(Cl)c4cccnc4c3O
Formula C26H21ClN4O2
Molecular Weight 456.92 da
Stereocenters 0/1