Molecular Definition

Canonical SMILES CC(C)(CC(=O)N1CCc2ccccc2C1)[C@H](N)C(=O)N3CCC[C@H]3C#N.OC(=O)C(F)(F)F
Formula C23H29F3N4O4
Molecular Weight 482.50 da
Stereocenters 2/2