Molecular Definition

Canonical SMILES COc1cc(OC)cc(\C=C\c2ccc3ccccc3c2)c1
Formula C20H18O2
Molecular Weight 290.36 da
Stereocenters 0/0