Molecular Definition

Canonical SMILES CN(c1cccc(Cl)c1)c2c(cnc3ccc(cc23)S(=O)(=O)C)C(=O)N
Formula C18H16ClN3O3S
Molecular Weight 389.86 da
Stereocenters 0/0