Molecular Definition

Canonical SMILES CC(C)(C)OC(=O)Nc1cccc(c1)c2onc(c2)C(=O)NCCCCC(=O)NO
Formula C20H26N4O6
Molecular Weight 418.44 da
Stereocenters 0/0