Molecular Definition

Canonical SMILES CC(C\C=C\C(=O)N(C)C)N(C)C
Formula C10H20N2O
Molecular Weight 184.28 da
Stereocenters 0/1