Molecular Definition

Canonical SMILES ONC(=O)CCCCNC(=O)c1cc(on1)c2ccccc2
Formula C15H17N3O4
Molecular Weight 303.31 da
Stereocenters 0/0