Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)C2=COc3cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)ccc3C2=O
Formula C22H22O9
Molecular Weight 430.40 da
Stereocenters 5/5