Target Relevance

Molecular Definition

Canonical SMILES CC1(C)CCC[C@@]2(C)[C@H]1CC[C@]3(C)OC4=CC(=O)C(=C(Cl)C4=C[C@H]23)O
Formula C21H27ClO3
Molecular Weight 362.89 da
Stereocenters 4/4