Molecular Definition

Canonical SMILES COc1cc2C=C3[C@](C)(CC[C@H]4C(C)(C)CCC[C@]34C)Oc2cc1O
Formula C22H30O3
Molecular Weight 342.47 da
Stereocenters 3/3