Molecular Definition

Canonical SMILES CC(C)(CC(=O)N[C@H]1C[C@@H]1c2cccc(Cl)c2)NCC(=O)N3CC(F)(F)C[C@H]3C#N
Formula C21H25ClF2N4O2
Molecular Weight 438.90 da
Stereocenters 3/3