Molecular Definition

Canonical SMILES CCc1nc2c(N)ncnc2n1[C@@H]3O[C@H](CN(C)CCCCON)[C@@H](O)[C@H]3O.OS(=O)(=O)O
Formula C17H31N7O8S
Molecular Weight 493.54 da
Stereocenters 4/4