Molecular Definition

Canonical SMILES CN(C)CCOc1ccc(\C=C\c2cc(ccn2)c3cc4C(=O)NC=Nc4[nH]3)cc1
Formula C23H23N5O2
Molecular Weight 401.46 da
Stereocenters 0/0