Molecular Definition

Canonical SMILES C[S+]([O-])c1ccc2cccc(CCNC(=O)C)c2c1
Formula C15H17NO2S
Molecular Weight 275.37 da
Stereocenters 0/1