Molecular Definition

Canonical SMILES CCCN1C(=O)N(CCC)c2c(O)c([nH]c2C1=O)c3ccc(OCC(=O)Nc4ccc(Br)cc4)cc3
Formula C26H27BrN4O5
Molecular Weight 555.42 da
Stereocenters 0/0