Molecular Definition

Canonical SMILES CC(C)n1c(C)ncc1c2ccnc(Nc3ccc(C(=O)NCCN(C)C)c(F)c3)n2
Formula C22H28FN7O
Molecular Weight 425.50 da
Stereocenters 0/0