Target Relevance

Molecular Definition

Canonical SMILES COc1ccc2[nH]c(C)c(CC(=O)N[C@@H](CCCCCC(=O)NCc3ccccc3)c4ncc([nH]4)c5ccc6ccccc6c5)c2c1
Formula C39H41N5O3
Molecular Weight 627.77 da
Stereocenters 1/1