Target Relevance

Molecular Definition

Canonical SMILES Cc1cc(C(=O)CCN2CCN(CC2)c3cccc4ccccc34)c(C)s1
Formula C23H26N2OS
Molecular Weight 378.53 da
Stereocenters 0/0